C15H17NO — CID 101476751
2-[(2,4,6-trimethylphenyl)iminomethyl]cyclopenta-2,4-dien-1-ol (PubChem CID 101476751) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[(2,4,6-trimethylphenyl)iminomethyl]cyclopenta-2,4-dien-1-ol.
| Compound Name | 2-[(2,4,6-trimethylphenyl)iminomethyl]cyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 101476751 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[(2,4,6-trimethylphenyl)iminomethyl]cyclopenta-2,4-dien-1-ol |
| SMILES | Cc1cc(C)c(/N=C/C2=CC=CC2O)c(C)c1 |
| InChI | InChI=1S/C15H17NO/c1-10-7-11(2)15(12(3)8-10)16-9-13-5-4-6-14(13)17/h4-9,14,17H,1-3H3/b16-9+ |
| InChIKey | YYXJMRWDKVZHFL-CXUHLZMHSA-N |
| XLogP | 3.17 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|