C19H30O9 — CID 101476921
(1S,3S,5R,8R)-1,5-dimethyl-8-(3-oxobutyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 101476921) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is (1S,3S,5R,8R)-1,5-dimethyl-8-(3-oxobutyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,3S,5R,8R)-1,5-dimethyl-8-(3-oxobutyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 101476921 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1S,3S,5R,8R)-1,5-dimethyl-8-(3-oxobutyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(=O)CC[C@H]1[C@@]2(C)C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C[C@]1(C)C(=O)O2 |
| InChI | InChI=1S/C19H30O9/c1-9(21)4-5-12-18(2)6-10(7-19(12,3)28-17(18)25)26-16-15(24)14(23)13(22)11(8-20)27-16/h10-16,20,22-24H,4-8H2,1-3H3/t10-,11+,12+,13+,14-,15+,16+,18-,19+/m0/s1 |
| InChIKey | BCGJKZWZEWXKHQ-QFQXQZQLSA-N |
| XLogP | -0.73 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |