About (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol
(2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol (PubChem CID 101477066) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol.
Molecular Properties
| Compound Name | (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol |
| PubChem CID | 101477066 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol |
| SMILES | CC(C)N1Cc2cccc(CO)c2C1 |
| InChI | InChI=1S/C12H17NO/c1-9(2)13-6-10-4-3-5-11(8-14)12(10)7-13/h3-5,9,14H,6-8H2,1-2H3 |
| InChIKey | VLJYMPRVWGMBIG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol?
The IUPAC name of (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol (CID 101477066) is (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol.
What is the SMILES notation for (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol?
The canonical SMILES for (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol is CC(C)N1Cc2cccc(CO)c2C1.
What is the InChIKey of (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol?
The InChIKey is VLJYMPRVWGMBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)13-6-10-4-3-5-11(8-14)12(10)7-13/h3-5,9,14H,6-8H2,1-2H3.
What are the key properties of (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol?
(2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol has a molecular weight of 191.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-yl-1,3-dihydroisoindol-4-yl)methanol is sourced from PubChem (CID 101477066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).