C11H11F3N2 — CID 101477526
2-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 101477526) has the molecular formula C11H11F3N2 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 101477526 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | FC(F)(F)c1ccc(C2=NCCCN2)cc1 |
| InChI | InChI=1S/C11H11F3N2/c12-11(13,14)9-4-2-8(3-5-9)10-15-6-1-7-16-10/h2-5H,1,6-7H2,(H,15,16) |
| InChIKey | GXSIFUXTFWUFAY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |