C25H25NO3 — CID 101477955
ethyl (2R,3R)-1-benzhydryl-3-(4-methoxyphenyl)aziridine-2-carboxylate (PubChem CID 101477955) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-3-(4-methoxyphenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-3-(4-methoxyphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101477955 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-3-(4-methoxyphenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccc(OC)cc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-3-29-25(27)24-23(20-14-16-21(28-2)17-15-20)26(24)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-17,22-24H,3H2,1-2H3/t23-,24-,26?/m1/s1 |
| InChIKey | MXTDWEPPYAMQLG-LBHOTPKDSA-N |
| XLogP | 4.77 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|