About (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide
(2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide (PubChem CID 101477981) has the molecular formula C25H25NO2
and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide |
| PubChem CID | 101477981 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide |
| SMILES | COc1ccc([C@@H]2C[C@H]2[C@H](C)C(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-18(23-17-24(23)19-13-15-22(28-2)16-14-19)25(27)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18,23-24H,17H2,1-2H3/t18-,23-,24-/m0/s1 |
| InChIKey | CRSGYXBRDMCDBA-NWVWQQAFSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide?
The IUPAC name of (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide (CID 101477981) is (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide.
What is the SMILES notation for (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide?
The canonical SMILES for (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide is COc1ccc([C@@H]2C[C@H]2[C@H](C)C(=O)N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide?
The InChIKey is CRSGYXBRDMCDBA-NWVWQQAFSA-N. The full InChI is InChI=1S/C25H25NO2/c1-18(23-17-24(23)19-13-15-22(28-2)16-14-19)25(27)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18,23-24H,17H2,1-2H3/t18-,23-,24-/m0/s1.
What are the key properties of (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide?
(2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide has a molecular weight of 371.48 g/mol, XLogP of 5.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1R,2R)-2-(4-methoxyphenyl)cyclopropyl]-N,N-diphenylpropanamide is sourced from PubChem (CID 101477981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).