C60H52N2 — CID 101478385
4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis[4-(4-methylphenyl)phenyl]benzene-1,3-diamine (PubChem CID 101478385) has the molecular formula C60H52N2 and a molecular weight of 801.09 g/mol. Its IUPAC name is 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis[4-(4-methylphenyl)phenyl]benzene-1,3-diamine.
| Compound Name | 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis[4-(4-methylphenyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 101478385 |
| Molecular Formula | C60H52N2 |
| Molecular Weight | 801.09 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis[4-(4-methylphenyl)phenyl]benzene-1,3-diamine |
| SMILES | Cc1ccc(-c2ccc(N(c3ccc(-c4ccc(C)cc4)cc3)c3cc(N(c4ccc(-c5ccc(C)cc5)cc4)c4ccc(-c5ccc(C)cc5)cc4)c(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C60H52N2/c1-41-7-15-47(16-8-41)51-23-31-55(32-24-51)61(56-33-25-52(26-34-56)48-17-9-42(2)10-18-48)59-40-60(46(6)39-45(59)5)62(57-35-27-53(28-36-57)49-19-11-43(3)12-20-49)58-37-29-54(30-38-58)50-21-13-44(4)14-22-50/h7-40H,1-6H3 |
| InChIKey | AULMACKHGRCYHE-UHFFFAOYSA-N |
| XLogP | 17.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.09 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |