About CID 101478464
CID 101478464 (PubChem CID 101478464) has the molecular formula C25H25O
and a molecular weight of 341.47 g/mol.
Molecular Properties
| Compound Name | CID 101478464 |
| PubChem CID | 101478464 |
| Molecular Formula | C25H25O |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | — |
| SMILES | CCC1(C)OC12C=C[C](C1CC1(c1ccccc1)c1ccccc1)C=C2 |
| InChI | InChI=1S/C25H25O/c1-3-23(2)24(26-23)16-14-19(15-17-24)22-18-25(22,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,22H,3,18H2,1-2H3 |
| InChIKey | SSAAEEUGIBCKDK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 101478464 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101478464?
The IUPAC name of CID 101478464 (CID 101478464) is not available.
What is the SMILES notation for CID 101478464?
The canonical SMILES for CID 101478464 is CCC1(C)OC12C=C[C](C1CC1(c1ccccc1)c1ccccc1)C=C2.
What is the InChIKey of CID 101478464?
The InChIKey is SSAAEEUGIBCKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25O/c1-3-23(2)24(26-23)16-14-19(15-17-24)22-18-25(22,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,22H,3,18H2,1-2H3.
What are the key properties of CID 101478464?
CID 101478464 has a molecular weight of 341.47 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101478464 is sourced from PubChem (CID 101478464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).