About 1-N,10-diphenylphenazin-10-ium-1,8-diamine
1-N,10-diphenylphenazin-10-ium-1,8-diamine (PubChem CID 101478710) has the molecular formula C24H19N4+
and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-N,10-diphenylphenazin-10-ium-1,8-diamine.
Molecular Properties
| Compound Name | 1-N,10-diphenylphenazin-10-ium-1,8-diamine |
| PubChem CID | 101478710 |
| Molecular Formula | C24H19N4+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-N,10-diphenylphenazin-10-ium-1,8-diamine |
| SMILES | Nc1ccc2nc3cccc(Nc4ccccc4)c3[n+](-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H18N4/c25-17-14-15-20-23(16-17)28(19-10-5-2-6-11-19)24-21(12-7-13-22(24)27-20)26-18-8-3-1-4-9-18/h1-16,25-26H/p+1 |
| InChIKey | HOJAWXDPTIQAJF-UHFFFAOYSA-O |
| XLogP | 4.99 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,10-diphenylphenazin-10-ium-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,10-diphenylphenazin-10-ium-1,8-diamine?
The IUPAC name of 1-N,10-diphenylphenazin-10-ium-1,8-diamine (CID 101478710) is 1-N,10-diphenylphenazin-10-ium-1,8-diamine.
What is the SMILES notation for 1-N,10-diphenylphenazin-10-ium-1,8-diamine?
The canonical SMILES for 1-N,10-diphenylphenazin-10-ium-1,8-diamine is Nc1ccc2nc3cccc(Nc4ccccc4)c3[n+](-c3ccccc3)c2c1.
What is the InChIKey of 1-N,10-diphenylphenazin-10-ium-1,8-diamine?
The InChIKey is HOJAWXDPTIQAJF-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H18N4/c25-17-14-15-20-23(16-17)28(19-10-5-2-6-11-19)24-21(12-7-13-22(24)27-20)26-18-8-3-1-4-9-18/h1-16,25-26H/p+1.
What are the key properties of 1-N,10-diphenylphenazin-10-ium-1,8-diamine?
1-N,10-diphenylphenazin-10-ium-1,8-diamine has a molecular weight of 363.44 g/mol, XLogP of 4.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,10-diphenylphenazin-10-ium-1,8-diamine is sourced from PubChem (CID 101478710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).