C32H30N2O6 — CID 101478835
ethyl (1R,3R,3aS,6aR)-4,6-dioxo-2-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-1,5-diphenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 101478835) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is ethyl (1R,3R,3aS,6aR)-4,6-dioxo-2-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-1,5-diphenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1R,3R,3aS,6aR)-4,6-dioxo-2-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-1,5-diphenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 101478835 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | ethyl (1R,3R,3aS,6aR)-4,6-dioxo-2-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-1,5-diphenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H](c2ccccc2)N1/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H30N2O6/c1-3-39-32(38)29-27-26(30(36)34(31(27)37)24-17-11-6-12-18-24)28(23-15-9-5-10-16-23)33(29)21(2)19-25(35)40-20-22-13-7-4-8-14-22/h4-19,26-29H,3,20H2,1-2H3/b21-19+/t26-,27+,28+,29-/m1/s1 |
| InChIKey | YUOKSPKCABAYHT-VMQDRGRSSA-N |
| XLogP | 4.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|