C19H26O12 — CID 101478847
ethyl (2S,3R,3aR,5S,6R,6aR)-2,3,6-triacetyloxy-5-(2-ethoxy-2-oxoethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate (PubChem CID 101478847) has the molecular formula C19H26O12 and a molecular weight of 446.41 g/mol. Its IUPAC name is ethyl (2S,3R,3aR,5S,6R,6aR)-2,3,6-triacetyloxy-5-(2-ethoxy-2-oxoethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate.
| Compound Name | ethyl (2S,3R,3aR,5S,6R,6aR)-2,3,6-triacetyloxy-5-(2-ethoxy-2-oxoethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 101478847 |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | ethyl (2S,3R,3aR,5S,6R,6aR)-2,3,6-triacetyloxy-5-(2-ethoxy-2-oxoethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
| SMILES | CCOC(=O)C[C@]1(C(=O)OCC)O[C@@H]2[C@@H](O[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H26O12/c1-6-25-12(23)8-19(18(24)26-7-2)16(28-10(4)21)14-13(31-19)15(27-9(3)20)17(30-14)29-11(5)22/h13-17H,6-8H2,1-5H3/t13-,14-,15-,16-,17-,19+/m1/s1 |
| InChIKey | KXBFRQORMYIEAP-UXAGXGOUSA-N |
| XLogP | -0.21 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|