C23H27NO2 — CID 101479039
2-methylpropyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 101479039) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 2-methylpropyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 2-methylpropyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 101479039 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-methylpropyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CC[C@@H]1c2ccccc2[C@@H](c2ccccc2)CN1C(=O)OCC(C)C |
| InChI | InChI=1S/C23H27NO2/c1-4-10-22-20-14-9-8-13-19(20)21(18-11-6-5-7-12-18)15-24(22)23(25)26-16-17(2)3/h4-9,11-14,17,21-22H,1,10,15-16H2,2-3H3/t21-,22-/m1/s1 |
| InChIKey | LADPIUYUYQNFLZ-FGZHOGPDSA-N |
| XLogP | 5.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|