C21H23NO2 — CID 101479040
ethyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 101479040) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | ethyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 101479040 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl (1R,4R)-4-phenyl-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CC[C@@H]1c2ccccc2[C@@H](c2ccccc2)CN1C(=O)OCC |
| InChI | InChI=1S/C21H23NO2/c1-3-10-20-18-14-9-8-13-17(18)19(16-11-6-5-7-12-16)15-22(20)21(23)24-4-2/h3,5-9,11-14,19-20H,1,4,10,15H2,2H3/t19-,20-/m1/s1 |
| InChIKey | PTAFBVNKCIAEKO-WOJBJXKFSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|