C12H19F9NOS+ — CID 101479853
[2-hydroxy-3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propyl]-trimethylazanium (PubChem CID 101479853) has the molecular formula C12H19F9NOS+ and a molecular weight of 396.34 g/mol. Its IUPAC name is [2-hydroxy-3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propyl]-trimethylazanium.
| Compound Name | [2-hydroxy-3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 101479853 |
| Molecular Formula | C12H19F9NOS+ |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [2-hydroxy-3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H19F9NOS/c1-22(2,3)6-8(23)7-24-5-4-9(13,14)10(15,16)11(17,18)12(19,20)21/h8,23H,4-7H2,1-3H3/q+1 |
| InChIKey | MXPRINKCJCMRKD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|