C21H19N — CID 101480114
2-[(1Z,4E)-5-naphthalen-1-ylpenta-1,4-dienyl]aniline (PubChem CID 101480114) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(1Z,4E)-5-naphthalen-1-ylpenta-1,4-dienyl]aniline.
| Compound Name | 2-[(1Z,4E)-5-naphthalen-1-ylpenta-1,4-dienyl]aniline |
|---|---|
| PubChem CID | 101480114 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[(1Z,4E)-5-naphthalen-1-ylpenta-1,4-dienyl]aniline |
| SMILES | Nc1ccccc1/C=C\C/C=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C21H19N/c22-21-16-7-5-12-19(21)11-3-1-2-9-17-13-8-14-18-10-4-6-15-20(17)18/h2-16H,1,22H2/b9-2+,11-3- |
| InChIKey | URZCZMABQQQCOT-UIGZESAKSA-N |
| XLogP | 5.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|