C25H24O3 — CID 101480182
methyl (1S,2S,4S,5R)-2-hydroxy-2,4,5-triphenylcyclopentane-1-carboxylate (PubChem CID 101480182) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is methyl (1S,2S,4S,5R)-2-hydroxy-2,4,5-triphenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2S,4S,5R)-2-hydroxy-2,4,5-triphenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101480182 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl (1S,2S,4S,5R)-2-hydroxy-2,4,5-triphenylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccccc2)[C@@H](c2ccccc2)C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C25H24O3/c1-28-24(26)23-22(19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)17-25(23,27)20-15-9-4-10-16-20/h2-16,21-23,27H,17H2,1H3/t21-,22-,23-,25-/m1/s1 |
| InChIKey | RVRYYPYPZIGUKF-VWBWNGLSSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |