About 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate
3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate (PubChem CID 101480358) has the molecular formula C10H15N5O3
and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate.
Molecular Properties
| Compound Name | 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate |
| PubChem CID | 101480358 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate |
| SMILES | [C-]#[N+][C@@H](C)C(=O)N[C@@H](C)C(=O)OCCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H15N5O3/c1-7(12-3)9(16)14-8(2)10(17)18-6-4-5-13-15-11/h7-8H,4-6H2,1-2H3,(H,14,16)/t7-,8-/m0/s1 |
| InChIKey | LTQJGWZRXPULPC-YUMQZZPRSA-N |
| XLogP | 1.04 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate?
The IUPAC name of 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate (CID 101480358) is 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate.
What is the SMILES notation for 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate?
The canonical SMILES for 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate is [C-]#[N+][C@@H](C)C(=O)N[C@@H](C)C(=O)OCCCN=[N+]=[N-].
What is the InChIKey of 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate?
The InChIKey is LTQJGWZRXPULPC-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H15N5O3/c1-7(12-3)9(16)14-8(2)10(17)18-6-4-5-13-15-11/h7-8H,4-6H2,1-2H3,(H,14,16)/t7-,8-/m0/s1.
What are the key properties of 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate?
3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate has a molecular weight of 253.26 g/mol, XLogP of 1.04, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidopropyl (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoate is sourced from PubChem (CID 101480358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).