C16H29NO — CID 101480433
(4S,9aR)-4-heptyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 101480433) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (4S,9aR)-4-heptyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | (4S,9aR)-4-heptyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 101480433 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (4S,9aR)-4-heptyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | CCCCCCC[C@H]1CC(=O)C[C@H]2CCCCN21 |
| InChI | InChI=1S/C16H29NO/c1-2-3-4-5-6-9-14-12-16(18)13-15-10-7-8-11-17(14)15/h14-15H,2-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | KHZXQJVQACBSBT-LSDHHAIUSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|