About [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate
[(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate (PubChem CID 101480580) has the molecular formula C12H9F6NO3S
and a molecular weight of 361.26 g/mol. Its IUPAC name is [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate |
| PubChem CID | 101480580 |
| Molecular Formula | C12H9F6NO3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C([C@H](C#N)OS(=O)(=O)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F6NO3S/c1-7-2-4-8(5-3-7)10(11(13,14)15)9(6-19)22-23(20,21)12(16,17)18/h2-5,9-10H,1H3/t9-,10?/m0/s1 |
| InChIKey | CYOPYPUWOSFKSY-RGURZIINSA-N |
| XLogP | 3.40 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate?
The IUPAC name of [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate (CID 101480580) is [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate.
What is the SMILES notation for [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate?
The canonical SMILES for [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate is Cc1ccc(C([C@H](C#N)OS(=O)(=O)C(F)(F)F)C(F)(F)F)cc1.
What is the InChIKey of [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate?
The InChIKey is CYOPYPUWOSFKSY-RGURZIINSA-N. The full InChI is InChI=1S/C12H9F6NO3S/c1-7-2-4-8(5-3-7)10(11(13,14)15)9(6-19)22-23(20,21)12(16,17)18/h2-5,9-10H,1H3/t9-,10?/m0/s1.
What are the key properties of [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate?
[(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate has a molecular weight of 361.26 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyano-3,3,3-trifluoro-2-(4-methylphenyl)propyl] trifluoromethanesulfonate is sourced from PubChem (CID 101480580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).