C22H17NO3S — CID 101480588
(1R,9bR)-5,5-dioxo-1,9b-diphenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one (PubChem CID 101480588) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (1R,9bR)-5,5-dioxo-1,9b-diphenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one.
| Compound Name | (1R,9bR)-5,5-dioxo-1,9b-diphenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one |
|---|---|
| PubChem CID | 101480588 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (1R,9bR)-5,5-dioxo-1,9b-diphenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one |
| SMILES | O=C1C[C@H](c2ccccc2)[C@@]2(c3ccccc3)c3ccccc3S(=O)(=O)N12 |
| InChI | InChI=1S/C22H17NO3S/c24-21-15-19(16-9-3-1-4-10-16)22(17-11-5-2-6-12-17)18-13-7-8-14-20(18)27(25,26)23(21)22/h1-14,19H,15H2/t19-,22-/m1/s1 |
| InChIKey | XOHVVFWUWDYYET-DENIHFKCSA-N |
| XLogP | 3.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |