C22H15Cl2NO3S — CID 101480590
(1R,9bR)-1-(3,5-dichlorophenyl)-5,5-dioxo-9b-phenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one (PubChem CID 101480590) has the molecular formula C22H15Cl2NO3S and a molecular weight of 444.34 g/mol. Its IUPAC name is (1R,9bR)-1-(3,5-dichlorophenyl)-5,5-dioxo-9b-phenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one.
| Compound Name | (1R,9bR)-1-(3,5-dichlorophenyl)-5,5-dioxo-9b-phenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one |
|---|---|
| PubChem CID | 101480590 |
| Molecular Formula | C22H15Cl2NO3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (1R,9bR)-1-(3,5-dichlorophenyl)-5,5-dioxo-9b-phenyl-1,2-dihydropyrrolo[1,2-b][1,2]benzothiazol-3-one |
| SMILES | O=C1C[C@H](c2cc(Cl)cc(Cl)c2)[C@@]2(c3ccccc3)c3ccccc3S(=O)(=O)N12 |
| InChI | InChI=1S/C22H15Cl2NO3S/c23-16-10-14(11-17(24)12-16)19-13-21(26)25-22(19,15-6-2-1-3-7-15)18-8-4-5-9-20(18)29(25,27)28/h1-12,19H,13H2/t19-,22-/m1/s1 |
| InChIKey | BIECDQFSLVIUGP-DENIHFKCSA-N |
| XLogP | 4.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |