C23H17N2O — CID 101480674
CID 101480674 (PubChem CID 101480674) has the molecular formula C23H17N2O and a molecular weight of 337.40 g/mol.
| Compound Name | CID 101480674 |
|---|---|
| PubChem CID | 101480674 |
| Molecular Formula | C23H17N2O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | — |
| SMILES | [O]N(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C23H17N2O/c26-25(22-14-11-20(12-15-22)18-7-3-1-4-8-18)23-16-13-21(17-24-23)19-9-5-2-6-10-19/h1-17H |
| InChIKey | DYTPSDQASNHBQM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|