About CID 101480674
CID 101480674 (PubChem CID 101480674) has the molecular formula C23H17N2O
and a molecular weight of 337.40 g/mol.
Molecular Properties
| Compound Name | CID 101480674 |
| PubChem CID | 101480674 |
| Molecular Formula | C23H17N2O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | — |
| SMILES | [O]N(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C23H17N2O/c26-25(22-14-11-20(12-15-22)18-7-3-1-4-8-18)23-16-13-21(17-24-23)19-9-5-2-6-10-19/h1-17H |
| InChIKey | DYTPSDQASNHBQM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 101480674 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101480674?
The IUPAC name of CID 101480674 (CID 101480674) is not available.
What is the SMILES notation for CID 101480674?
The canonical SMILES for CID 101480674 is [O]N(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cn1.
What is the InChIKey of CID 101480674?
The InChIKey is DYTPSDQASNHBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N2O/c26-25(22-14-11-20(12-15-22)18-7-3-1-4-8-18)23-16-13-21(17-24-23)19-9-5-2-6-10-19/h1-17H.
What are the key properties of CID 101480674?
CID 101480674 has a molecular weight of 337.40 g/mol, XLogP of 5.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101480674 is sourced from PubChem (CID 101480674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).