C15H17ClO3 — CID 101481522
methyl 2-[(5S,8S,8aS)-3-chloro-8-methyl-2-oxo-4,5,8,8a-tetrahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 101481522) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is methyl 2-[(5S,8S,8aS)-3-chloro-8-methyl-2-oxo-4,5,8,8a-tetrahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(5S,8S,8aS)-3-chloro-8-methyl-2-oxo-4,5,8,8a-tetrahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101481522 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl 2-[(5S,8S,8aS)-3-chloro-8-methyl-2-oxo-4,5,8,8a-tetrahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1C=C[C@H](C)[C@@H]2CC(=O)C(Cl)=C2C1 |
| InChI | InChI=1S/C15H17ClO3/c1-8-4-5-10(9(2)15(18)19-3)6-12-11(8)7-13(17)14(12)16/h4-5,8,10-11H,2,6-7H2,1,3H3/t8-,10+,11-/m0/s1 |
| InChIKey | NKSKEWFYJMZLJG-GDPRMGEGSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|