About 2-(2,5-dimethylphenyl)selenolane
2-(2,5-dimethylphenyl)selenolane (PubChem CID 101482181) has the molecular formula C12H16Se
and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)selenolane.
Molecular Properties
| Compound Name | 2-(2,5-dimethylphenyl)selenolane |
| PubChem CID | 101482181 |
| Molecular Formula | C12H16Se |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(2,5-dimethylphenyl)selenolane |
| SMILES | Cc1ccc(C)c(C2CCC[Se]2)c1 |
| InChI | InChI=1S/C12H16Se/c1-9-5-6-10(2)11(8-9)12-4-3-7-13-12/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | DOEJXDZNQAMQIQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylphenyl)selenolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylphenyl)selenolane?
The IUPAC name of 2-(2,5-dimethylphenyl)selenolane (CID 101482181) is 2-(2,5-dimethylphenyl)selenolane.
What is the SMILES notation for 2-(2,5-dimethylphenyl)selenolane?
The canonical SMILES for 2-(2,5-dimethylphenyl)selenolane is Cc1ccc(C)c(C2CCC[Se]2)c1.
What is the InChIKey of 2-(2,5-dimethylphenyl)selenolane?
The InChIKey is DOEJXDZNQAMQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Se/c1-9-5-6-10(2)11(8-9)12-4-3-7-13-12/h5-6,8,12H,3-4,7H2,1-2H3.
What are the key properties of 2-(2,5-dimethylphenyl)selenolane?
2-(2,5-dimethylphenyl)selenolane has a molecular weight of 239.22 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylphenyl)selenolane is sourced from PubChem (CID 101482181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).