C25H42O3Si — CID 101482421
triethyl-[(1'R,3'R,7'R,9'Z,11'R)-10'-methyl-2'-methylidenespiro[1,3-dioxolane-2,14'-tricyclo[9.4.0.03,7]pentadec-9-ene]-3'-yl]oxysilane (PubChem CID 101482421) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is triethyl-[(1'R,3'R,7'R,9'Z,11'R)-10'-methyl-2'-methylidenespiro[1,3-dioxolane-2,14'-tricyclo[9.4.0.03,7]pentadec-9-ene]-3'-yl]oxysilane.
| Compound Name | triethyl-[(1'R,3'R,7'R,9'Z,11'R)-10'-methyl-2'-methylidenespiro[1,3-dioxolane-2,14'-tricyclo[9.4.0.03,7]pentadec-9-ene]-3'-yl]oxysilane |
|---|---|
| PubChem CID | 101482421 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | triethyl-[(1'R,3'R,7'R,9'Z,11'R)-10'-methyl-2'-methylidenespiro[1,3-dioxolane-2,14'-tricyclo[9.4.0.03,7]pentadec-9-ene]-3'-yl]oxysilane |
| SMILES | C=C1[C@@H]2CC3(CC[C@H]2/C(C)=C\C[C@H]2CCC[C@]12O[Si](CC)(CC)CC)OCCO3 |
| InChI | InChI=1S/C25H42O3Si/c1-6-29(7-2,8-3)28-25-14-9-10-21(25)12-11-19(4)22-13-15-24(26-16-17-27-24)18-23(22)20(25)5/h11,21-23H,5-10,12-18H2,1-4H3/b19-11-/t21-,22+,23+,25+/m1/s1 |
| InChIKey | MWJRFJOCWVHDIM-ODCOHACOSA-N |
| XLogP | 6.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|