About cyclobuta-1,3-diene-1,3-dicarbonitrile
cyclobuta-1,3-diene-1,3-dicarbonitrile (PubChem CID 101482688) has the molecular formula C6H2N2
and a molecular weight of 102.10 g/mol. Its IUPAC name is cyclobuta-1,3-diene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | cyclobuta-1,3-diene-1,3-dicarbonitrile |
| PubChem CID | 101482688 |
| Molecular Formula | C6H2N2 |
| Molecular Weight | 102.10 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | cyclobuta-1,3-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=CC(C#N)=C1 |
| InChI | InChI=1S/C6H2N2/c7-3-5-1-6(2-5)4-8/h1-2H |
| InChIKey | BKMBXNOVQPKJFF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.10 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobuta-1,3-diene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobuta-1,3-diene-1,3-dicarbonitrile?
The IUPAC name of cyclobuta-1,3-diene-1,3-dicarbonitrile (CID 101482688) is cyclobuta-1,3-diene-1,3-dicarbonitrile.
What is the SMILES notation for cyclobuta-1,3-diene-1,3-dicarbonitrile?
The canonical SMILES for cyclobuta-1,3-diene-1,3-dicarbonitrile is N#CC1=CC(C#N)=C1.
What is the InChIKey of cyclobuta-1,3-diene-1,3-dicarbonitrile?
The InChIKey is BKMBXNOVQPKJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N2/c7-3-5-1-6(2-5)4-8/h1-2H.
What are the key properties of cyclobuta-1,3-diene-1,3-dicarbonitrile?
cyclobuta-1,3-diene-1,3-dicarbonitrile has a molecular weight of 102.10 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobuta-1,3-diene-1,3-dicarbonitrile is sourced from PubChem (CID 101482688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).