C6H2N2 — CID 101482688
cyclobuta-1,3-diene-1,3-dicarbonitrile (PubChem CID 101482688) has the molecular formula C6H2N2 and a molecular weight of 102.10 g/mol. Its IUPAC name is cyclobuta-1,3-diene-1,3-dicarbonitrile.
| Compound Name | cyclobuta-1,3-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 101482688 |
| Molecular Formula | C6H2N2 |
| Molecular Weight | 102.10 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | cyclobuta-1,3-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=CC(C#N)=C1 |
| InChI | InChI=1S/C6H2N2/c7-3-5-1-6(2-5)4-8/h1-2H |
| InChIKey | BKMBXNOVQPKJFF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.10 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |