About [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone
[(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone (PubChem CID 101482715) has the molecular formula C16H20O
and a molecular weight of 228.34 g/mol. Its IUPAC name is [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone.
Molecular Properties
| Compound Name | [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone |
| PubChem CID | 101482715 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone |
| SMILES | C[C@@]12CCC[C@@H](C[C@H]1C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H20O/c1-16-9-5-6-12(11-16)10-14(16)15(17)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14-,16-/m0/s1 |
| InChIKey | QPISMHRYYNZJTI-NOLJZWGESA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone?
The IUPAC name of [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone (CID 101482715) is [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone.
What is the SMILES notation for [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone?
The canonical SMILES for [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone is C[C@@]12CCC[C@@H](C[C@H]1C(=O)c1ccccc1)C2.
What is the InChIKey of [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone?
The InChIKey is QPISMHRYYNZJTI-NOLJZWGESA-N. The full InChI is InChI=1S/C16H20O/c1-16-9-5-6-12(11-16)10-14(16)15(17)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14-,16-/m0/s1.
What are the key properties of [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone?
[(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone has a molecular weight of 228.34 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5S,6R)-5-methyl-6-bicyclo[3.2.1]octanyl]-phenylmethanone is sourced from PubChem (CID 101482715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).