C30H24O12 — CID 101483199
(2R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-2H-chromene-3,5,7-triol (PubChem CID 101483199) has the molecular formula C30H24O12 and a molecular weight of 576.51 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-2H-chromene-3,5,7-triol.
| Compound Name | (2R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 101483199 |
| Molecular Formula | C30H24O12 |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-2H-chromene-3,5,7-triol |
| SMILES | OC1=C(c2c(O)cc(O)c3c2O[C@H](c2ccc(O)c(O)c2)[C@H](O)C3)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C30H24O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,28-29,31-40H,9H2/t22-,28-,29-/m1/s1 |
| InChIKey | ANVLEFSPVPIQRX-RNOQYBQRSA-N |
| XLogP | 3.82 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|