C25H18N2O6 — CID 101483315
(2S,4R,15R,17S)-3,16-dioxa-21,25-diazanonacyclo[23.2.1.118,21.02,6.04,27.05,10.09,14.013,17.015,19]nonacosa-5,7,9,11,13-pentaene-20,26,28,29-tetrone (PubChem CID 101483315) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is (2S,4R,15R,17S)-3,16-dioxa-21,25-diazanonacyclo[23.2.1.118,21.02,6.04,27.05,10.09,14.013,17.015,19]nonacosa-5,7,9,11,13-pentaene-20,26,28,29-tetrone.
| Compound Name | (2S,4R,15R,17S)-3,16-dioxa-21,25-diazanonacyclo[23.2.1.118,21.02,6.04,27.05,10.09,14.013,17.015,19]nonacosa-5,7,9,11,13-pentaene-20,26,28,29-tetrone |
|---|---|
| PubChem CID | 101483315 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2S,4R,15R,17S)-3,16-dioxa-21,25-diazanonacyclo[23.2.1.118,21.02,6.04,27.05,10.09,14.013,17.015,19]nonacosa-5,7,9,11,13-pentaene-20,26,28,29-tetrone |
| SMILES | O=C1C2C3C(=O)N1CCCN1C(=O)C4C(C1=O)[C@H]1O[C@@H]4c4ccc5c6c(ccc5c41)[C@H]2O[C@@H]63 |
| InChI | InChI=1S/C25H18N2O6/c28-22-14-17-21-13-9-3-5-11-12(8(9)2-4-10(13)18(14)32-21)20-16-15(19(11)33-20)23(29)27(24(16)30)7-1-6-26(22)25(17)31/h2-5,14-21H,1,6-7H2/t14?,15?,16?,17?,18-,19-,20+,21+/m1/s1 |
| InChIKey | XNCSLDZTPUSQFM-VMFJHSMZSA-N |
| XLogP | 1.70 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|