C46H36F2N6O5 — CID 101483565
2-[4,5-bis[[bis(pyridin-4-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 101483565) has the molecular formula C46H36F2N6O5 and a molecular weight of 790.83 g/mol. Its IUPAC name is 2-[4,5-bis[[bis(pyridin-4-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[4,5-bis[[bis(pyridin-4-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 101483565 |
| Molecular Formula | C46H36F2N6O5 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.27 |
| IUPAC Name | 2-[4,5-bis[[bis(pyridin-4-ylmethyl)amino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(F)c(=O)c(CN(Cc3ccncc3)Cc3ccncc3)c-2oc2c(CN(Cc3ccncc3)Cc3ccncc3)c(O)c(F)cc12 |
| InChI | InChI=1S/C46H36F2N6O5/c47-39-21-35-41(33-3-1-2-4-34(33)46(57)58)36-22-40(48)43(56)38(28-54(25-31-9-17-51-18-10-31)26-32-11-19-52-20-12-32)45(36)59-44(35)37(42(39)55)27-53(23-29-5-13-49-14-6-29)24-30-7-15-50-16-8-30/h1-22,55H,23-28H2,(H,57,58) |
| InChIKey | RVQHUZLYGLRTRQ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|