C29H44O3Si — CID 101483841
3-(4-tert-butylphenyl)-1-[4-[(6R)-1,4-dioxaspiro[4.5]decan-6-yl]-3-trimethylsilylbut-1-ynyl]cyclobutan-1-ol (PubChem CID 101483841) has the molecular formula C29H44O3Si and a molecular weight of 468.75 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[4-[(6R)-1,4-dioxaspiro[4.5]decan-6-yl]-3-trimethylsilylbut-1-ynyl]cyclobutan-1-ol.
| Compound Name | 3-(4-tert-butylphenyl)-1-[4-[(6R)-1,4-dioxaspiro[4.5]decan-6-yl]-3-trimethylsilylbut-1-ynyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 101483841 |
| Molecular Formula | C29H44O3Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[4-[(6R)-1,4-dioxaspiro[4.5]decan-6-yl]-3-trimethylsilylbut-1-ynyl]cyclobutan-1-ol |
| SMILES | CC(C)(C)c1ccc(C2CC(O)(C#CC(C[C@H]3CCCCC34OCCO4)[Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C29H44O3Si/c1-27(2,3)24-12-10-22(11-13-24)23-20-28(30,21-23)16-14-26(33(4,5)6)19-25-9-7-8-15-29(25)31-17-18-32-29/h10-13,23,25-26,30H,7-9,15,17-21H2,1-6H3/t23?,25-,26?,28?/m1/s1 |
| InChIKey | WANRZYRHPOEHBX-XTQVYNAZSA-N |
| XLogP | 6.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|