C30H42NO5+ — CID 101484036
dimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxymethyl]oxan-2-yl]azanium (PubChem CID 101484036) has the molecular formula C30H42NO5+ and a molecular weight of 496.67 g/mol. Its IUPAC name is dimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxymethyl]oxan-2-yl]azanium.
| Compound Name | dimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxymethyl]oxan-2-yl]azanium |
|---|---|
| PubChem CID | 101484036 |
| Molecular Formula | C30H42NO5+ |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | dimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(2-methylpropan-2-yl)oxymethyl]oxan-2-yl]azanium |
| SMILES | CC(C)(C)OC[C@H]1O[C@@H]([N+](C)(C)CCC=C2c3ccccc3CCc3ccccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H42NO5/c1-30(2,3)35-19-25-26(32)27(33)28(34)29(36-25)31(4,5)18-10-15-24-22-13-8-6-11-20(22)16-17-21-12-7-9-14-23(21)24/h6-9,11-15,25-29,32-34H,10,16-19H2,1-5H3/q+1/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | JBARQBFUEFWGBL-XYPQWYOHSA-N |
| XLogP | 3.31 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|