C14H18F3NO2 — CID 101484257
tert-butyl N-[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]carbamate (PubChem CID 101484257) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101484257 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl N-[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-13(2,3)20-12(19)18-11(14(15,16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | QELKKVYZJHOEEE-LLVKDONJSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |