C11H28N4Si3 — CID 101484474
N,N,1-tris(trimethylsilyl)-1,2,4-triazol-3-amine (PubChem CID 101484474) has the molecular formula C11H28N4Si3 and a molecular weight of 300.63 g/mol. Its IUPAC name is N,N,1-tris(trimethylsilyl)-1,2,4-triazol-3-amine.
| Compound Name | N,N,1-tris(trimethylsilyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 101484474 |
| Molecular Formula | C11H28N4Si3 |
| Molecular Weight | 300.63 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N,N,1-tris(trimethylsilyl)-1,2,4-triazol-3-amine |
| SMILES | C[Si](C)(C)N(c1ncn([Si](C)(C)C)n1)[Si](C)(C)C |
| InChI | InChI=1S/C11H28N4Si3/c1-16(2,3)14-10-12-11(13-14)15(17(4,5)6)18(7,8)9/h10H,1-9H3 |
| InChIKey | YHMNIJBEAAZTDB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|