C18H26BN3O2 — CID 101485310
1-benzyl-4-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (PubChem CID 101485310) has the molecular formula C18H26BN3O2 and a molecular weight of 327.24 g/mol. Its IUPAC name is 1-benzyl-4-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole.
| Compound Name | 1-benzyl-4-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
|---|---|
| PubChem CID | 101485310 |
| Molecular Formula | C18H26BN3O2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-benzyl-4-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| SMILES | CCCc1nnn(Cc2ccccc2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BN3O2/c1-6-10-15-16(19-23-17(2,3)18(4,5)24-19)22(21-20-15)13-14-11-8-7-9-12-14/h7-9,11-12H,6,10,13H2,1-5H3 |
| InChIKey | GJQFUQHZAGZNNS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|