C39H48N2O5+2 — CID 101485741
anthracen-9-ylmethyl-[[4-[2-[2-[2-[4-[(4-hydroxybutylazaniumyl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]azanium (PubChem CID 101485741) has the molecular formula C39H48N2O5+2 and a molecular weight of 624.82 g/mol. Its IUPAC name is anthracen-9-ylmethyl-[[4-[2-[2-[2-[4-[(4-hydroxybutylazaniumyl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]azanium.
| Compound Name | anthracen-9-ylmethyl-[[4-[2-[2-[2-[4-[(4-hydroxybutylazaniumyl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 101485741 |
| Molecular Formula | C39H48N2O5+2 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | anthracen-9-ylmethyl-[[4-[2-[2-[2-[4-[(4-hydroxybutylazaniumyl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]azanium |
| SMILES | OCCCC[NH2+]Cc1ccc(OCCOCCOCCOc2ccc(C[NH2+]Cc3c4ccccc4cc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C39H46N2O5/c42-20-6-5-19-40-28-31-11-15-35(16-12-31)45-25-23-43-21-22-44-24-26-46-36-17-13-32(14-18-36)29-41-30-39-37-9-3-1-7-33(37)27-34-8-2-4-10-38(34)39/h1-4,7-18,27,40-42H,5-6,19-26,28-30H2/p+2 |
| InChIKey | FWKJLJSUNLYVKQ-UHFFFAOYSA-P |
| XLogP | 4.58 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|