C54H66O9 — CID 101486311
1-[2-(4-decoxyphenyl)ethynyl]-3,5-bis[2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethynyl]benzene (PubChem CID 101486311) has the molecular formula C54H66O9 and a molecular weight of 859.11 g/mol. Its IUPAC name is 1-[2-(4-decoxyphenyl)ethynyl]-3,5-bis[2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethynyl]benzene.
| Compound Name | 1-[2-(4-decoxyphenyl)ethynyl]-3,5-bis[2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 101486311 |
| Molecular Formula | C54H66O9 |
| Molecular Weight | 859.11 g/mol |
| Exact Mass | 858.47 |
| IUPAC Name | 1-[2-(4-decoxyphenyl)ethynyl]-3,5-bis[2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethynyl]benzene |
| SMILES | CCCCCCCCCCOc1ccc(C#Cc2cc(C#Cc3ccc(OCCOCCOCCOC)cc3)cc(C#Cc3ccc(OCCOCCOCCOC)cc3)c2)cc1 |
| InChI | InChI=1S/C54H66O9/c1-4-5-6-7-8-9-10-11-30-61-52-24-18-46(19-25-52)12-15-49-43-50(16-13-47-20-26-53(27-21-47)62-41-39-59-37-35-57-33-31-55-2)45-51(44-49)17-14-48-22-28-54(29-23-48)63-42-40-60-38-36-58-34-32-56-3/h18-29,43-45H,4-11,30-42H2,1-3H3 |
| InChIKey | KSASRHZUPASOMS-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.11 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|