About 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one
4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 101486539) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 101486539 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | CC(C)C(=O)c1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C13H13NO3/c1-8(2)12(15)10-11(14-17-13(10)16)9-6-4-3-5-7-9/h3-8,14H,1-2H3 |
| InChIKey | QTTLBYRHHODCOR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one?
The IUPAC name of 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one (CID 101486539) is 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one is CC(C)C(=O)c1c(-c2ccccc2)[nH]oc1=O.
What is the InChIKey of 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one?
The InChIKey is QTTLBYRHHODCOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-8(2)12(15)10-11(14-17-13(10)16)9-6-4-3-5-7-9/h3-8,14H,1-2H3.
What are the key properties of 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one?
4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one has a molecular weight of 231.25 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropanoyl)-3-phenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 101486539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).