C46H53NO6Si — CID 101486838
(1S)-1-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol (PubChem CID 101486838) has the molecular formula C46H53NO6Si and a molecular weight of 744.02 g/mol. Its IUPAC name is (1S)-1-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol.
| Compound Name | (1S)-1-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 101486838 |
| Molecular Formula | C46H53NO6Si |
| Molecular Weight | 744.02 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | (1S)-1-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol |
| SMILES | CC(C)(C)[Si](OC[C@H](O)[C@H]1CC2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H53NO6Si/c1-46(2,3)54(38-25-15-7-16-26-38,39-27-17-8-18-28-39)52-34-42(48)43-29-40-44(50-31-36-21-11-5-12-22-36)45(51-32-37-23-13-6-14-24-37)41(47(40)53-43)33-49-30-35-19-9-4-10-20-35/h4-28,40-45,48H,29-34H2,1-3H3/t40?,41-,42+,43-,44-,45-/m1/s1 |
| InChIKey | JAWNUJHPAIEWTC-YULNGZSUSA-N |
| XLogP | 7.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.02 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|