C39H76O7Si3 — CID 101486874
ethyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate (PubChem CID 101486874) has the molecular formula C39H76O7Si3 and a molecular weight of 741.29 g/mol. Its IUPAC name is ethyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate.
| Compound Name | ethyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate |
|---|---|
| PubChem CID | 101486874 |
| Molecular Formula | C39H76O7Si3 |
| Molecular Weight | 741.29 g/mol |
| Exact Mass | 740.49 |
| IUPAC Name | ethyl (5S,7S,9E,11Z,13R,14R,16E)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-18-hydroxy-14-methyl-3-oxooctadeca-9,11,16-trienoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](C[C@H](C/C=C/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C/CO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H76O7Si3/c1-18-43-36(42)29-32(41)28-34(45-48(14,15)38(6,7)8)30-33(44-47(12,13)37(3,4)5)25-20-19-21-26-35(31(2)24-22-23-27-40)46-49(16,17)39(9,10)11/h19-23,26,31,33-35,40H,18,24-25,27-30H2,1-17H3/b20-19+,23-22+,26-21-/t31-,33+,34-,35+/m1/s1 |
| InChIKey | NGAKKXCRXFWNGN-UERAECPNSA-N |
| XLogP | 10.54 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.29 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|