C13H23NO2 — CID 101487151
tert-butyl N-[(1S)-cyclohept-2-en-1-yl]-N-methylcarbamate (PubChem CID 101487151) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl N-[(1S)-cyclohept-2-en-1-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S)-cyclohept-2-en-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 101487151 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl N-[(1S)-cyclohept-2-en-1-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1C=CCCCC1 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)16-12(15)14(4)11-9-7-5-6-8-10-11/h7,9,11H,5-6,8,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | CPXHSVYITIXCFX-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|