C19H23N3 — CID 101487295
1,2,3-tris(cyclopenta-2,4-dien-1-ylmethyl)guanidine (PubChem CID 101487295) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1,2,3-tris(cyclopenta-2,4-dien-1-ylmethyl)guanidine.
| Compound Name | 1,2,3-tris(cyclopenta-2,4-dien-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 101487295 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1,2,3-tris(cyclopenta-2,4-dien-1-ylmethyl)guanidine |
| SMILES | C1=CC(CN=C(NCC2C=CC=C2)NCC2C=CC=C2)C=C1 |
| InChI | InChI=1S/C19H23N3/c1-2-8-16(7-1)13-20-19(21-14-17-9-3-4-10-17)22-15-18-11-5-6-12-18/h1-12,16-18H,13-15H2,(H2,20,21,22) |
| InChIKey | SHXZCGSQLBLURV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|