C21H20N2O — CID 101487875
(5R)-1-benzyl-5-(5-ethenyl-1H-indol-3-yl)pyrrolidin-2-one (PubChem CID 101487875) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is (5R)-1-benzyl-5-(5-ethenyl-1H-indol-3-yl)pyrrolidin-2-one.
| Compound Name | (5R)-1-benzyl-5-(5-ethenyl-1H-indol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 101487875 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (5R)-1-benzyl-5-(5-ethenyl-1H-indol-3-yl)pyrrolidin-2-one |
| SMILES | C=Cc1ccc2[nH]cc([C@H]3CCC(=O)N3Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C21H20N2O/c1-2-15-8-9-19-17(12-15)18(13-22-19)20-10-11-21(24)23(20)14-16-6-4-3-5-7-16/h2-9,12-13,20,22H,1,10-11,14H2/t20-/m1/s1 |
| InChIKey | OGGYLSCHSGJIHO-HXUWFJFHSA-N |
| XLogP | 4.67 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |