C30H29ClO — CID 101488163
(Z)-2-(2-chlorophenyl)-6-cyclohexyl-3,4-diphenylhex-3-en-5-yn-2-ol (PubChem CID 101488163) has the molecular formula C30H29ClO and a molecular weight of 441.01 g/mol. Its IUPAC name is (Z)-2-(2-chlorophenyl)-6-cyclohexyl-3,4-diphenylhex-3-en-5-yn-2-ol.
| Compound Name | (Z)-2-(2-chlorophenyl)-6-cyclohexyl-3,4-diphenylhex-3-en-5-yn-2-ol |
|---|---|
| PubChem CID | 101488163 |
| Molecular Formula | C30H29ClO |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (Z)-2-(2-chlorophenyl)-6-cyclohexyl-3,4-diphenylhex-3-en-5-yn-2-ol |
| SMILES | CC(O)(/C(=C(\C#CC1CCCCC1)c1ccccc1)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C30H29ClO/c1-30(32,27-19-11-12-20-28(27)31)29(25-17-9-4-10-18-25)26(24-15-7-3-8-16-24)22-21-23-13-5-2-6-14-23/h3-4,7-12,15-20,23,32H,2,5-6,13-14H2,1H3/b29-26+ |
| InChIKey | PRTYMAYNOUVFBL-PBBVDAKRSA-N |
| XLogP | 7.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|