C16H25IO3 — CID 101488281
tert-butyl (2E,4E,6R,8Z)-9-iodo-6-methoxy-2,5-dimethylnona-2,4,8-trienoate (PubChem CID 101488281) has the molecular formula C16H25IO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is tert-butyl (2E,4E,6R,8Z)-9-iodo-6-methoxy-2,5-dimethylnona-2,4,8-trienoate.
| Compound Name | tert-butyl (2E,4E,6R,8Z)-9-iodo-6-methoxy-2,5-dimethylnona-2,4,8-trienoate |
|---|---|
| PubChem CID | 101488281 |
| Molecular Formula | C16H25IO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | tert-butyl (2E,4E,6R,8Z)-9-iodo-6-methoxy-2,5-dimethylnona-2,4,8-trienoate |
| SMILES | CO[C@H](C/C=C\I)/C(C)=C/C=C(\C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25IO3/c1-12(14(19-6)8-7-11-17)9-10-13(2)15(18)20-16(3,4)5/h7,9-11,14H,8H2,1-6H3/b11-7-,12-9+,13-10+/t14-/m1/s1 |
| InChIKey | RJBNOXIXUYGZOW-KHULJMSPSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|