C21H36O6SSi — CID 101488289
[(E,2R,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroxyhex-4-enyl] 4-methylbenzenesulfonate (PubChem CID 101488289) has the molecular formula C21H36O6SSi and a molecular weight of 444.67 g/mol. Its IUPAC name is [(E,2R,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroxyhex-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2R,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroxyhex-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101488289 |
| Molecular Formula | C21H36O6SSi |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [(E,2R,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dihydroxyhex-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C/C=C/[C@@H](O)[C@@](O)(CCO[Si](C)(C)C(C)(C)C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H36O6SSi/c1-8-9-19(22)21(23,14-15-27-29(6,7)20(3,4)5)16-26-28(24,25)18-12-10-17(2)11-13-18/h8-13,19,22-23H,14-16H2,1-7H3/b9-8+/t19-,21-/m1/s1 |
| InChIKey | SFMILOWTJQIUOI-AUGFPLSNSA-N |
| XLogP | 3.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|