C18H18O6 — CID 101488359
(1S,4E,16R,17R)-14-methoxy-5-methyl-9,11,18,20-tetraoxapentacyclo[14.2.2.01,17.07,15.08,12]icosa-4,7,12,14-tetraen-19-one (PubChem CID 101488359) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (1S,4E,16R,17R)-14-methoxy-5-methyl-9,11,18,20-tetraoxapentacyclo[14.2.2.01,17.07,15.08,12]icosa-4,7,12,14-tetraen-19-one.
| Compound Name | (1S,4E,16R,17R)-14-methoxy-5-methyl-9,11,18,20-tetraoxapentacyclo[14.2.2.01,17.07,15.08,12]icosa-4,7,12,14-tetraen-19-one |
|---|---|
| PubChem CID | 101488359 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (1S,4E,16R,17R)-14-methoxy-5-methyl-9,11,18,20-tetraoxapentacyclo[14.2.2.01,17.07,15.08,12]icosa-4,7,12,14-tetraen-19-one |
| SMILES | COc1cc2c(c3c1[C@H]1OC(=O)[C@@]4(CC/C=C(\C)C3)O[C@H]14)OCO2 |
| InChI | InChI=1S/C18H18O6/c1-9-4-3-5-18-16(24-18)15(23-17(18)19)13-10(6-9)14-12(21-8-22-14)7-11(13)20-2/h4,7,15-16H,3,5-6,8H2,1-2H3/b9-4+/t15-,16-,18+/m1/s1 |
| InChIKey | AZEXZDCGEODDBX-WJOJUABBSA-N |
| XLogP | 2.44 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|