C19H25N3O4 — CID 101488897
(R)-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanol (PubChem CID 101488897) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (R)-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanol.
| Compound Name | (R)-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 101488897 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (R)-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanol |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1[C@@H](O)C1=NO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H25N3O4/c1-11(2)15-18(24-3)21-16(19(20-15)25-4)17(23)13-10-14(26-22-13)12-8-6-5-7-9-12/h5-9,11,14-17,23H,10H2,1-4H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | ZJYRNDHBSULQCV-NCOADZHNSA-N |
| XLogP | 2.36 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |