C25H22N2O3 — CID 101489179
[2-(1-acetyl-2-phenyl-2,3-dihydro-1,5-benzodiazepin-4-yl)phenyl] acetate (PubChem CID 101489179) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(1-acetyl-2-phenyl-2,3-dihydro-1,5-benzodiazepin-4-yl)phenyl] acetate.
| Compound Name | [2-(1-acetyl-2-phenyl-2,3-dihydro-1,5-benzodiazepin-4-yl)phenyl] acetate |
|---|---|
| PubChem CID | 101489179 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-(1-acetyl-2-phenyl-2,3-dihydro-1,5-benzodiazepin-4-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C1=Nc2ccccc2N(C(C)=O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H22N2O3/c1-17(28)27-23-14-8-7-13-21(23)26-22(16-24(27)19-10-4-3-5-11-19)20-12-6-9-15-25(20)30-18(2)29/h3-15,24H,16H2,1-2H3 |
| InChIKey | QCSMIAJVBSOCOM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|