C21H33BrO6 — CID 101489558
(4S)-4-[(1S,3S,6S,8R,11R,14S)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]-4-methyl-1,3-dioxolan-2-one (PubChem CID 101489558) has the molecular formula C21H33BrO6 and a molecular weight of 461.39 g/mol. Its IUPAC name is (4S)-4-[(1S,3S,6S,8R,11R,14S)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]-4-methyl-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-[(1S,3S,6S,8R,11R,14S)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]-4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 101489558 |
| Molecular Formula | C21H33BrO6 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (4S)-4-[(1S,3S,6S,8R,11R,14S)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]-4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1(C)O[C@@H]2CC[C@@]3(C)O[C@H]([C@]4(C)COC(=O)O4)CC[C@@H]3O[C@@]2(C)CC[C@@H]1Br |
| InChI | InChI=1S/C21H33BrO6/c1-18(2)13(22)8-10-19(3)16(25-18)9-11-20(4)14(26-19)6-7-15(27-20)21(5)12-24-17(23)28-21/h13-16H,6-12H2,1-5H3/t13-,14-,15-,16+,19-,20+,21-/m0/s1 |
| InChIKey | OFUVFJPFNLILPZ-HMOFNGKSSA-N |
| XLogP | 4.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|